On Target P2RX3_HUMAN 0.31308413/CHEMBL4111666
For the given ligand dd106, we have found in our database that, being scored 0.31308413, the most similar ligand is CHEMBL4111666. Check out the elaboration below.
| dd106 (Given Ligand) | CHEMBL4111666 (Similar Ligand) |
|---|---|
| C[NH+](C)CCCOc2c(Br)cc(/C=C/C(=O)NCCCOc1c(Br)cc(CC[NH+](C)C)cc1Br)cc2Br | CC(C)Oc1ccc(NC2=NC(=O)\C(=C\c3ccccc3)\C(=O)N2Cc4ccc(Cl)cc4)cc1Cl |
|
|
|
|
|
|
| 04004000 10009008 20100508 01010600 00001000 02000000 82140080 08000400 41800000 00480840 18200000 c0008000 00808012 00010001 01000003 00082008 20200400 02000100 00818000 00824200 00000000 18300600 01000081 91400018 00000001 80000000 005a2000 40010000 05400200 00060803 04000008 0a000640 | 0400804e 00808418 20100108 12410e00 00041040 00200004 8a110484 43003409 01800300 01520952 11200014 40009800 0a809c66 00018009 01000443 00190008 20044c00 02400500 08118010 00824a01 c0030100 3a018700 20028010 00402019 00113080 c0008800 404f3200 d0010080 0a408390 10068011 24140008 84024300 |