On Target 5HT2A_HUMAN 0.4871795/CHEMBL360968
For the given ligand dd106, we have found in our database that, being scored 0.4871795, the most similar ligand is CHEMBL360968. Check out the elaboration below.
| dd106 (Given Ligand) | CHEMBL360968 (Similar Ligand) |
|---|---|
| C[NH+](C)CCCOc2c(Br)cc(/C=C/C(=O)NCCCOc1c(Br)cc(CC[NH+](C)C)cc1Br)cc2Br | CCOc1cc2CCNCC(C)c2cc1Br |
|
|
|
|
|
|
| 04004000 10009008 20100508 01010600 00001000 02000000 82140080 08000400 41800000 00480840 18200000 c0008000 00808012 00010001 01000003 00082008 20200400 02000100 00818000 00824200 00000000 18300600 01000081 91400018 00000001 80000000 005a2000 40010000 05400200 00060803 04000008 0a000640 | 04004000 52008008 20100108 01010600 00001020 80000000 02040000 00000001 40000080 00080840 08200000 c0808000 00800012 20200081 01000001 00080008 00000200 02100400 00080000 00024200 00000000 18200000 00004000 81400010 00000000 80000000 00120000 00000000 05000200 00060002 00000008 08002600 |