On Target P2Y12_HUMAN 0.2819383/CHEMBL585306
For the given ligand dd106, we have found in our database that, being scored 0.2819383, the most similar ligand is CHEMBL585306. Check out the elaboration below.
| dd106 (Given Ligand) | CHEMBL585306 (Similar Ligand) |
|---|---|
| C[NH+](C)CCCOc2c(Br)cc(/C=C/C(=O)NCCCOc1c(Br)cc(CC[NH+](C)C)cc1Br)cc2Br | CCc1cc2c(nc(NC(=O)NCCC(=O)O)nc2s1)N3CCN(CC3)C(=O)CCOc4ccccc4 |
|
|
|
|
|
|
| 04004000 10009008 20100508 01010600 00001000 02000000 82140080 08000400 41800000 00480840 18200000 c0008000 00808012 00010001 01000003 00082008 20200400 02000100 00818000 00824200 00000000 18300600 01000081 91400018 00000001 80000000 005a2000 40010000 05400200 00060803 04000008 0a000640 | 04014002 1100780b 20180138 4c090e04 02101008 02205000 0208a084 1000a888 00000300 00481a40 00300224 e01a9080 1c90901a 0001a000 01402001 001c241c 00340000 0200401d 08e00030 00a20204 c0100900 7e1d0ea0 2180c8e1 1260001a 0201200b 0c000100 40080000 000000c4 08400a18 00460883 40001000 00c107c0 |