On Target CXCR1_HUMAN 0.27403846/CHEMBL490688
For the given ligand dd106, we have found in our database that, being scored 0.27403846, the most similar ligand is CHEMBL490688. Check out the elaboration below.
| dd106 (Given Ligand) | CHEMBL490688 (Similar Ligand) |
|---|---|
| C[NH+](C)CCCOc2c(Br)cc(/C=C/C(=O)NCCCOc1c(Br)cc(CC[NH+](C)C)cc1Br)cc2Br | CN(C)C(=O)c1cccc(Nc2nsnc2N[C@@H](c3ccc4OCCOc4c3)C(C)(C)C)c1O |
|
|
|
|
|
|
| 04004000 10009008 20100508 01010600 00001000 02000000 82140080 08000400 41800000 00480840 18200000 c0008000 00808012 00010001 01000003 00082008 20200400 02000100 00818000 00824200 00000000 18300600 01000081 91400018 00000001 80000000 005a2000 40010000 05400200 00060803 04000008 0a000640 | 14010002 46010888 20100109 01210e20 20001000 48020010 02040210 0a101600 00803900 00080851 88352004 4000c880 0a80c812 20100081 01240041 100ce00c 00040000 1a005000 08080012 10024201 41100100 18228f00 25010010 08458015 00840002 80800480 20320000 80800090 20408308 1006000b c6041000 00010600 |