On Target PGH2_HUMAN 0.5182482/CHEMBL3233601
For the given ligand dd106, we have found in our database that, being scored 0.5182482, the most similar ligand is CHEMBL3233601. Check out the elaboration below.
| dd106 (Given Ligand) | CHEMBL3233601 (Similar Ligand) |
|---|---|
| C[NH+](C)CCCOc2c(Br)cc(/C=C/C(=O)NCCCOc1c(Br)cc(CC[NH+](C)C)cc1Br)cc2Br | COc1ccc(cc1)C2=C(C(=O)N(C)C2=O)c3ccc(cc3)S(=O)(=O)N |
|
|
|
|
|
|
| 04004000 10009008 20100508 01010600 00001000 02000000 82140080 08000400 41800000 00480840 18200000 c0008000 00808012 00010001 01000003 00082008 20200400 02000100 00818000 00824200 00000000 18300600 01000081 91400018 00000001 80000000 005a2000 40010000 05400200 00060803 04000008 0a000640 | 00000010 00809008 21100108 00b10600 00001008 08000000 82040080 00000404 01800080 00480840 08202100 60009000 01008002 00010001 c1200003 00000008 20000400 02000100 40218000 00822200 80020000 18240700 00000001 89400018 00000000 88000000 00522000 40010128 04400200 20060003 0c002000 00012620 |