On Target TRY1_HUMAN 0.43421054/CHEMBL85154
For the given ligand dd106, we have found in our database that, being scored 0.43421054, the most similar ligand is CHEMBL85154. Check out the elaboration below.
| dd106 (Given Ligand) | CHEMBL85154 (Similar Ligand) |
|---|---|
| C[NH+](C)CCCOc2c(Br)cc(/C=C/C(=O)NCCCOc1c(Br)cc(CC[NH+](C)C)cc1Br)cc2Br | C\C(=C/c1ccc(cc1)C(=O)Oc2ccc(cc2)C(=N)N)\C(=O)N(CC=C)CC(=O)O.CS(=O)(=O)O |
|
|
|
|
|
|
| 04004000 10009008 20100508 01010600 00001000 02000000 82140080 08000400 41800000 00480840 18200000 c0008000 00808012 00010001 01000003 00082008 20200400 02000100 00818000 00824200 00000000 18300600 01000081 91400018 00000001 80000000 005a2000 40010000 05400200 00060803 04000008 0a000640 | 04000000 0000c808 20100108 40550600 00001080 00004000 82140080 00001600 01800100 00400843 00202800 c000b000 02808802 00010002 81090003 02080008 30020400 02000100 00018000 00820200 01000000 18028e20 12000002 00c0101c 00000000 80002000 406a2000 40010020 00400208 00060001 ec044000 12010220 |