On Target 5HT1B_HUMAN 0.4827586/CHEMBL344127
For the given ligand dd106, we have found in our database that, being scored 0.4827586, the most similar ligand is CHEMBL344127. Check out the elaboration below.
| dd106 (Given Ligand) | CHEMBL344127 (Similar Ligand) |
|---|---|
| C[NH+](C)CCCOc2c(Br)cc(/C=C/C(=O)NCCCOc1c(Br)cc(CC[NH+](C)C)cc1Br)cc2Br | COc1ccc(CNC(=O)\C=C\c2ccc3[nH]cc(CCN(C)C)c3c2)cc1 |
|
|
|
|
|
|
| 04004000 10009008 20100508 01010600 00001000 02000000 82140080 08000400 41800000 00480840 18200000 c0008000 00808012 00010001 01000003 00082008 20200400 02000100 00818000 00824200 00000000 18300600 01000081 91400018 00000001 80000000 005a2000 40010000 05400200 00060803 04000008 0a000640 | 00000002 00808808 20100108 41010610 00041000 00000000 82142080 02001400 01c00100 00490840 08200004 40008800 10008802 00410000 01000443 0004000c 20000400 02000104 00218400 00820000 c1000000 18208608 20800000 91400018 00042000 c0000000 086a2240 c0010000 04400300 00060003 24040200 00000620 |