On Target TLR4_HUMAN 0.29069766/CHEMBL1824677
For the given ligand dd106, we have found in our database that, being scored 0.29069766, the most similar ligand is CHEMBL1824677. Check out the elaboration below.
| dd106 (Given Ligand) | CHEMBL1824677 (Similar Ligand) |
|---|---|
| C[NH+](C)CCCOc2c(Br)cc(/C=C/C(=O)NCCCOc1c(Br)cc(CC[NH+](C)C)cc1Br)cc2Br | CN(CC(O)COc1ccccc1)Cc2c(C)nn(Cc3ccccc3)c2C |
|
|
|
|
|
|
| 04004000 10009008 20100508 01010600 00001000 02000000 82140080 08000400 41800000 00480840 18200000 c0008000 00808012 00010001 01000003 00082008 20200400 02000100 00818000 00824200 00000000 18300600 01000081 91400018 00000001 80000000 005a2000 40010000 05400200 00060803 04000008 0a000640 | 0400000c 44001208 20100188 10010610 010810c0 02000002 0204c000 00001000 80100000 000008c0 02200008 40018000 00801822 00a00000 01240c01 000c200c 18220008 82800000 00c80000 00220200 00020000 1801a800 07800881 8b540010 00014001 c0000000 0002c000 90800000 05001304 00060008 200c0000 00000260 |