On Target CXCR4_HUMAN 0.35877863/CHEMBL126657
For the given ligand dd106, we have found in our database that, being scored 0.35877863, the most similar ligand is CHEMBL126657. Check out the elaboration below.
| dd106 (Given Ligand) | CHEMBL126657 (Similar Ligand) |
|---|---|
| C[NH+](C)CCCOc2c(Br)cc(/C=C/C(=O)NCCCOc1c(Br)cc(CC[NH+](C)C)cc1Br)cc2Br | COc1cc(\C=C\C(=O)c2ccc(Cl)cc2)ccc1O |
|
|
|
|
|
|
| 04004000 10009008 20100508 01010600 00001000 02000000 82140080 08000400 41800000 00480840 18200000 c0008000 00808012 00010001 01000003 00082008 20200400 02000100 00818000 00824200 00000000 18300600 01000081 91400018 00000001 80000000 005a2000 40010000 05400200 00060803 04000008 0a000640 | 00008000 40000808 20000308 00010200 00001000 00800000 82000081 00000400 01800000 00b80840 08000000 40108800 0200c026 00000000 01000003 00008008 00000400 02100000 00098000 00020a00 00000000 08020300 00008001 00400014 01002000 80000000 00462000 40000000 00400200 00020102 84000000 00020500 |