On Target CNR2_HUMAN 0.661157/CHEMBL3410833
For the given ligand dd106, we have found in our database that, being scored 0.661157, the most similar ligand is CHEMBL3410833. Check out the elaboration below.
| dd106 (Given Ligand) | CHEMBL3410833 (Similar Ligand) |
|---|---|
| C[NH+](C)CCCOc2c(Br)cc(/C=C/C(=O)NCCCOc1c(Br)cc(CC[NH+](C)C)cc1Br)cc2Br | CCCCCOc1cc(\C=C\C(=O)NCCc2ccc(O)cc2)ccc1OC |
|
|
|
|
|
|
| 04004000 10009008 20100508 01010600 00001000 02000000 82140080 08000400 41800000 00480840 18200000 c0008000 00808012 00010001 01000003 00082008 20200400 02000100 00818000 00824200 00000000 18300600 01000081 91400018 00000001 80000000 005a2000 40010000 05400200 00060803 04000008 0a000640 | 04000000 41009008 20100108 00210700 00081000 02000000 82140080 00000404 01800080 00480840 08200000 40108000 0080c002 00010080 11000003 0208a008 20800400 02000100 00498000 00820201 00000000 18200600 01000001 81400018 00000000 80000000 005a2000 40010000 04400200 0006010b 04000000 02000740 |