On Target MTOR_HUMAN 0.30952382/CHEMBL1090131
For the given ligand dd106, we have found in our database that, being scored 0.30952382, the most similar ligand is CHEMBL1090131. Check out the elaboration below.
| dd106 (Given Ligand) | CHEMBL1090131 (Similar Ligand) |
|---|---|
| C[NH+](C)CCCOc2c(Br)cc(/C=C/C(=O)NCCCOc1c(Br)cc(CC[NH+](C)C)cc1Br)cc2Br | COc1ccc2c(c1)c(\C=C\3/Oc4cc(O)cc(O)c4C3=O)cn2CCN5CCN(CCCO)CC5 |
|
|
|
|
|
|
| 04004000 10009008 20100508 01010600 00001000 02000000 82140080 08000400 41800000 00480840 18200000 c0008000 00808012 00010001 01000003 00082008 20200400 02000100 00818000 00824200 00000000 18300600 01000081 91400018 00000001 80000000 005a2000 40010000 05400200 00060803 04000008 0a000640 | 04001003 00000c08 20110309 46010612 00041044 02820100 c60c0281 00004640 01a60008 00b828c1 88a58004 4001c100 80808806 00402000 03040843 004c205c 08000400 82900000 04a38000 00020a02 40000000 3a028218 218080a3 82580014 09042001 90000000 a8522808 50000000 08414308 20060012 84040210 00002620 |