On Target OPRX_HUMAN 0.41353384/CHEMBL425225
For the given ligand dd106, we have found in our database that, being scored 0.41353384, the most similar ligand is CHEMBL425225. Check out the elaboration below.
| dd106 (Given Ligand) | CHEMBL425225 (Similar Ligand) |
|---|---|
| C[NH+](C)CCCOc2c(Br)cc(/C=C/C(=O)NCCCOc1c(Br)cc(CC[NH+](C)C)cc1Br)cc2Br | O=C(NCCCN1CCC2(CC1)CCc3ccccc23)\C=C\c4ccccc4 |
|
|
|
|
|
|
| 04004000 10009008 20100508 01010600 00001000 02000000 82140080 08000400 41800000 00480840 18200000 c0008000 00808012 00010001 01000003 00082008 20200400 02000100 00818000 00824200 00000000 18300600 01000081 91400018 00000001 80000000 005a2000 40010000 05400200 00060803 04000008 0a000640 | 00000000 01009600 00100102 00010600 00000000 00000002 80100080 20000401 01800800 004809e0 08300000 50018000 00008002 00211000 00000002 02060000 20000400 02000100 0001a000 00800201 00000100 18080610 00004000 00500018 00000000 80000001 00482000 50010000 00400002 0006001b 04000000 02002600 |