On Target FYN_HUMAN 0.33540374/CHEMBL1986590
For the given ligand dd106, we have found in our database that, being scored 0.33540374, the most similar ligand is CHEMBL1986590. Check out the elaboration below.
| dd106 (Given Ligand) | CHEMBL1986590 (Similar Ligand) |
|---|---|
| C[NH+](C)CCCOc2c(Br)cc(/C=C/C(=O)NCCCOc1c(Br)cc(CC[NH+](C)C)cc1Br)cc2Br | O=C1Nc2ccccc2C1=Cc3c[nH]c4ccccc34 |
|
|
|
|
|
|
| 04004000 10009008 20100508 01010600 00001000 02000000 82140080 08000400 41800000 00480840 18200000 c0008000 00808012 00010001 01000003 00082008 20200400 02000100 00818000 00824200 00000000 18300600 01000081 91400018 00000001 80000000 005a2000 40010000 05400200 00060803 04000008 0a000640 | 00004202 00008800 00100100 02010610 20041004 04000000 80000080 00020400 01800000 00482840 08280104 60009008 01008800 00510000 c0020142 00440004 20040400 02000100 08238000 00800002 40100000 1a208608 20822000 81400011 00040000 82000201 08402010 40011280 04408000 00060003 04042200 20002620 |