On Target CAH2_HUMAN 0.45255473/CHEMBL4072219
For the given ligand dd106, we have found in our database that, being scored 0.45255473, the most similar ligand is CHEMBL4072219. Check out the elaboration below.
| dd106 (Given Ligand) | CHEMBL4072219 (Similar Ligand) |
|---|---|
| C[NH+](C)CCCOc2c(Br)cc(/C=C/C(=O)NCCCOc1c(Br)cc(CC[NH+](C)C)cc1Br)cc2Br | CC(C)Oc1ccc(\C=C\C(=O)Nc2ccc(cc2)S(=O)(=O)N)cc1 |
|
|
|
|
|
|
| 04004000 10009008 20100508 01010600 00001000 02000000 82140080 08000400 41800000 00480840 18200000 c0008000 00808012 00010001 01000003 00082008 20200400 02000100 00818000 00824200 00000000 18300600 01000081 91400018 00000001 80000000 005a2000 40010000 05400200 00060803 04000008 0a000640 | 04004212 0080a008 21000108 00b10600 00001010 00000000 82040080 00000408 01800000 00400840 00282004 60008008 00808002 00110001 81200043 00080008 20040400 02000100 08018000 00822000 c0100000 08000600 20002001 08400018 00000000 80000000 00422000 400100c8 00408200 20060001 04000000 00010220 |