On Target ESR1_HUMAN 0.56557375/CHEMBL4078577
For the given ligand dd106, we have found in our database that, being scored 0.56557375, the most similar ligand is CHEMBL4078577. Check out the elaboration below.
| dd106 (Given Ligand) | CHEMBL4078577 (Similar Ligand) |
|---|---|
| C[NH+](C)CCCOc2c(Br)cc(/C=C/C(=O)NCCCOc1c(Br)cc(CC[NH+](C)C)cc1Br)cc2Br | OCCCNC(=O)\C=C\c1ccc(cc1)C(=C2C3CC4CC(CC2C4)C3)c5ccc(O)cc5 |
|
|
|
|
|
|
| 04004000 10009008 20100508 01010600 00001000 02000000 82140080 08000400 41800000 00480840 18200000 c0008000 00808012 00010001 01000003 00082008 20200400 02000100 00818000 00824200 00000000 18300600 01000081 91400018 00000001 80000000 005a2000 40010000 05400200 00060803 04000008 0a000640 | 00000000 01009008 20100300 00010600 00000000 00000000 82100080 01000400 01800100 00580840 08200000 40008800 00028002 00010000 00000402 00080008 20000400 02000100 0281a000 00820201 01000000 18100600 010080a1 00400018 01000001 a0000000 005a6000 c0010000 00400080 00060003 24020000 02000600 |