On Target 5HT2C_HUMAN 0.5046729/CHEMBL138807
For the given ligand dd106, we have found in our database that, being scored 0.5046729, the most similar ligand is CHEMBL138807. Check out the elaboration below.
| dd106 (Given Ligand) | CHEMBL138807 (Similar Ligand) |
|---|---|
| C[NH+](C)CCCOc2c(Br)cc(/C=C/C(=O)NCCCOc1c(Br)cc(CC[NH+](C)C)cc1Br)cc2Br | COc1ccc2cccc(C(CO)CNC(=O)C)c2c1 |
|
|
|
|
|
|
| 04004000 10009008 20100508 01010600 00001000 02000000 82140080 08000400 41800000 00480840 18200000 c0008000 00808012 00010001 01000003 00082008 20200400 02000100 00818000 00824200 00000000 18300600 01000081 91400018 00000001 80000000 005a2000 40010000 05400200 00060803 04000008 0a000640 | 00000000 00001008 20100108 00010600 00001040 00000000 02040000 00000004 00000080 00080840 08200000 40008000 00008002 00000000 01040001 00080008 08000000 02000000 00800000 00020200 00000000 18300608 01000080 81400018 00000001 80000000 00120000 00000000 04000200 00060003 00000000 00000600 |