On Target PTGES_HUMAN 0.3617021/CHEMBL3754065
For the given ligand dd106, we have found in our database that, being scored 0.3617021, the most similar ligand is CHEMBL3754065. Check out the elaboration below.
| dd106 (Given Ligand) | CHEMBL3754065 (Similar Ligand) |
|---|---|
| C[NH+](C)CCCOc2c(Br)cc(/C=C/C(=O)NCCCOc1c(Br)cc(CC[NH+](C)C)cc1Br)cc2Br | COc1ccc(\C=C\c2ccc3O[C@H]([C@H](c4ccc(OC)cc4)c3c2)c5ccc(O)cc5)cc1 |
|
|
|
|
|
|
| 04004000 10009008 20100508 01010600 00001000 02000000 82140080 08000400 41800000 00480840 18200000 c0008000 00808012 00010001 01000003 00082008 20200400 02000100 00818000 00824200 00000000 18300600 01000081 91400018 00000001 80000000 005a2000 40010000 05400200 00060803 04000008 0a000640 | 04001000 00000008 20000108 00010200 00001041 82004000 82040080 01000640 00000900 00080840 08100100 40008240 00800002 00010000 01040003 02082018 48000400 02008000 04000000 00020001 00000100 18100020 01000001 02c01010 00004000 e0002000 00522008 40000004 00404380 00220002 46000000 00000500 |