On Target MIF_HUMAN 0.28301886/CHEMBL3797437
For the given ligand dd106, we have found in our database that, being scored 0.28301886, the most similar ligand is CHEMBL3797437. Check out the elaboration below.
| dd106 (Given Ligand) | CHEMBL3797437 (Similar Ligand) |
|---|---|
| C[NH+](C)CCCOc2c(Br)cc(/C=C/C(=O)NCCCOc1c(Br)cc(CC[NH+](C)C)cc1Br)cc2Br | Oc1cc2OCOc2cc1C(N3CCOCC3)c4ccc(cc4)C(F)(F)F |
|
|
|
|
|
|
| 04004000 10009008 20100508 01010600 00001000 02000000 82140080 08000400 41800000 00480840 18200000 c0008000 00808012 00010001 01000003 00082008 20200400 02000100 00818000 00824200 00000000 18300600 01000081 91400018 00000001 80000000 005a2000 40010000 05400200 00060803 04000008 0a000640 | 00000009 46000008 20100108 80010600 00001080 00000000 42040400 03001600 00200100 00180850 48200000 40008800 80004802 21000000 01001409 0028a108 10000000 02000000 00080000 00020a00 00040200 08008000 12000000 00468010 40000400 e0000000 003a0100 f0000001 01040380 00060002 06140000 02010600 |