On Target HRH1_HUMAN 0.50735295/CHEMBL292275
For the given ligand dd106, we have found in our database that, being scored 0.50735295, the most similar ligand is CHEMBL292275. Check out the elaboration below.
| dd106 (Given Ligand) | CHEMBL292275 (Similar Ligand) |
|---|---|
| C[NH+](C)CCCOc2c(Br)cc(/C=C/C(=O)NCCCOc1c(Br)cc(CC[NH+](C)C)cc1Br)cc2Br | CCOC(=O)N1CCN(CCCOc2ccc(cc2)C(=O)\C=C\c3ccc(OC)cc3)CC1 |
|
|
|
|
|
|
| 04004000 10009008 20100508 01010600 00001000 02000000 82140080 08000400 41800000 00480840 18200000 c0008000 00808012 00010001 01000003 00082008 20200400 02000100 00818000 00824200 00000000 18300600 01000081 91400018 00000001 80000000 005a2000 40010000 05400200 00060803 04000008 0a000640 | 04000000 00402808 20100309 04010600 00001000 02810000 82040081 00000408 01800200 00b80840 08200000 40008000 00808002 00002000 01000003 001a2008 00220400 02100000 00818800 00020a00 00000000 38020e10 010080a1 0240001c 01000001 80000002 00522000 40200020 08400200 00060003 84000000 00000640 |