On Target IKKB_HUMAN 0.39370078/CHEMBL485008
For the given ligand dd106, we have found in our database that, being scored 0.39370078, the most similar ligand is CHEMBL485008. Check out the elaboration below.
| dd106 (Given Ligand) | CHEMBL485008 (Similar Ligand) |
|---|---|
| C[NH+](C)CCCOc2c(Br)cc(/C=C/C(=O)NCCCOc1c(Br)cc(CC[NH+](C)C)cc1Br)cc2Br | Brc1cc2ccncc2cc1OC3CCNCC3 |
|
|
|
|
|
|
| 04004000 10009008 20100508 01010600 00001000 02000000 82140080 08000400 41800000 00480840 18200000 c0008000 00808012 00010001 01000003 00082008 20200400 02000100 00818000 00824200 00000000 18300600 01000081 91400018 00000001 80000000 005a2000 40010000 05400200 00060803 04000008 0a000640 | 04004002 01008008 20104108 01010600 00041000 02000000 02080000 00000000 00000000 000008c0 00200004 50018000 00800816 00400001 01000041 000c200c 00200000 00000000 00a00000 00024201 40000000 18008008 21800080 90000010 00002001 00000000 00020000 10000000 00000200 000e0000 00040008 08000240 |