On Target MK03_HUMAN 0.30875576/CHEMBL3577644
For the given ligand dd106, we have found in our database that, being scored 0.30875576, the most similar ligand is CHEMBL3577644. Check out the elaboration below.
| dd106 (Given Ligand) | CHEMBL3577644 (Similar Ligand) |
|---|---|
| C[NH+](C)CCCOc2c(Br)cc(/C=C/C(=O)NCCCOc1c(Br)cc(CC[NH+](C)C)cc1Br)cc2Br | COc1ccc(cc1)N2C(=O)\C(=C\c3ccc(OCC(=O)Nc4cccc(Cl)c4)cc3)\N=C2c5ccccc5 |
|
|
|
|
|
|
| 04004000 10009008 20100508 01010600 00001000 02000000 82140080 08000400 41800000 00480840 18200000 c0008000 00808012 00010001 01000003 00082008 20200400 02000100 00818000 00824200 00000000 18300600 01000081 91400018 00000001 80000000 005a2000 40010000 05400200 00060803 04000008 0a000640 | 0440e602 00848018 20305128 09410602 40041080 00200000 9a140480 03211408 01800102 00410e43 102c0014 6000e808 02808866 08118009 01041443 00180008 20040c00 92004300 08018000 18824008 c0332000 280487c0 32012001 02404008 00002480 c0000000 484e2208 c4050080 0a408398 00068001 44840080 04020200 |