On Target PERM_HUMAN 0.3227513/CHEMBL3739661
For the given ligand lvkui, we have found in our database that, being scored 0.3227513, the most similar ligand is CHEMBL3739661. Check out the elaboration below.
| lvkui (Given Ligand) | CHEMBL3739661 (Similar Ligand) |
|---|---|
| CC(C)c3ccc2oc1nc(N)c(C(=O)O)cc1c(=O)c2c3 | Fc1ccc2NC(=S)N(NC(=O)c3ccc(cc3)C(F)(F)F)C(=O)c2c1 |
|
|
|
|
|
|
| 00000002 00a40800 00084100 00010210 00041600 80014060 00000400 40000200 02084120 40080850 08000024 4000b002 40008c00 01600088 00020050 000c000c 00000000 42004004 04200080 00600000 c8000000 0e068a68 20a04800 8078001c 08040050 80000005 88000090 18140000 00402008 01860002 c0140000 80000400 | 0008000e 00000c00 00100100 42010600 02140080 00004030 02010400 00003a00 06284120 400d0870 05000004 40008000 c0008c00 01601000 00000040 000c0005 10000010 03408000 00600020 00010000 40080100 08038628 62800040 02500204 00100000 e0200000 20010100 90040041 08006080 004f8012 c0140000 80010e88 |