On Target PDE5A_HUMAN 0.39130434/CHEMBL4069398
For the given ligand lvkui, we have found in our database that, being scored 0.39130434, the most similar ligand is CHEMBL4069398. Check out the elaboration below.
| lvkui (Given Ligand) | CHEMBL4069398 (Similar Ligand) |
|---|---|
| CC(C)c3ccc2oc1nc(N)c(C(=O)O)cc1c(=O)c2c3 | COC(=O)c1[nH]c(Cc2ccc(O)cc2)c3Oc4ccccc4C(=O)c13 |
|
|
|
|
|
|
| 00000002 00a40800 00084100 00010210 00041600 80014060 00000400 40000200 02084120 40080850 08000024 4000b002 40008c00 01600088 00020050 000c000c 00000000 42004004 04200080 00600000 c8000000 0e068a68 20a04800 8078001c 08040050 80000005 88000090 18140000 00402008 01860002 c0140000 80000400 | 0000000a 80204808 22080100 50050600 00040621 80084120 02200000 41001208 020a4300 c0888840 0c088124 42808800 40008c02 00710088 40022040 520c428c 00028020 02844005 02200000 00060000 40004000 08068a68 a0806002 045c0114 0a000002 a0006085 20520430 4a941010 00002284 09820007 c0040280 60000400 |