On Target TRPV1_RAT 0.34705883/CHEMBL215433
For the given ligand lvkui, we have found in our database that, being scored 0.34705883, the most similar ligand is CHEMBL215433. Check out the elaboration below.
| lvkui (Given Ligand) | CHEMBL215433 (Similar Ligand) |
|---|---|
| CC(C)c3ccc2oc1nc(N)c(C(=O)O)cc1c(=O)c2c3 | CC(C)(C)c1ccc(NC(=O)c2ccc(cc2)c3ncccc3C(=O)O)cc1 |
|
|
|
|
|
|
| 00000002 00a40800 00084100 00010210 00041600 80014060 00000400 40000200 02084120 40080850 08000024 4000b002 40008c00 01600088 00020050 000c000c 00000000 42004004 04200080 00600000 c8000000 0e068a68 20a04800 8078001c 08040050 80000005 88000090 18140000 00402008 01860002 c0140000 80000400 | 0800e002 00800801 00004100 50010610 00041020 0000c000 00000000 02081000 00400100 10080840 08288004 4000c800 82008800 00308000 20020040 020c000c 00060000 02002004 0c200000 10400000 c0100000 08068e40 30812000 0040001c 00040000 80000000 08000040 800000c0 0040c104 00060403 c0040800 00000600 |