On Target SC6A4_HUMAN 0.3626943/CHEMBL439849
For the given ligand lvkui, we have found in our database that, being scored 0.3626943, the most similar ligand is CHEMBL439849. Check out the elaboration below.
| lvkui (Given Ligand) | CHEMBL439849 (Similar Ligand) |
|---|---|
| CC(C)c3ccc2oc1nc(N)c(C(=O)O)cc1c(=O)c2c3 | NC(=O)c1oc2ccc(cc2c1)N3CCN(CCCCc4c[nH]c5ccc(cc45)C#N)CC3 |
|
|
|
|
|
|
| 00000002 00a40800 00084100 00010210 00041600 80014060 00000400 40000200 02084120 40080850 08000024 4000b002 40008c00 01600088 00020050 000c000c 00000000 42004004 04200080 00600000 c8000000 0e068a68 20a04800 8078001c 08040050 80000005 88000090 18140000 00402008 01860002 c0140000 80000400 | 00004082 01200800 00180122 44810610 04041320 00000000 00002000 60201200 02504900 00880ac0 08300064 40a19800 48008c02 00602880 00000060 00040004 00444000 02000004 0ca00400 00000a01 40100100 38068608 20800421 82580216 08042020 a0000000 0c100454 18000080 0840a080 01060402 80040200 00000620 |