On Target AMPN_HUMAN 0.26872247/CHEMBL1077591
For the given ligand lvkui, we have found in our database that, being scored 0.26872247, the most similar ligand is CHEMBL1077591. Check out the elaboration below.
| lvkui (Given Ligand) | CHEMBL1077591 (Similar Ligand) |
|---|---|
| CC(C)c3ccc2oc1nc(N)c(C(=O)O)cc1c(=O)c2c3 | CC[C@H](C)[C@H](NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](N)C(C)C)C(=O)N[C@H]2Cc3c(CN(CC(=O)N[C@@H](Cc4ccccc4)C(=O)O)C2=O)[nH]c5ccccc35 |
|
|
|
|
|
|
| 00000002 00a40800 00084100 00010210 00041600 80014060 00000400 40000200 02084120 40080850 08000024 4000b002 40008c00 01600088 00020050 000c000c 00000000 42004004 04200080 00600000 c8000000 0e068a68 20a04800 8078001c 08040050 80000005 88000090 18140000 00402008 01860002 c0140000 80000400 | 0001800a 0180fa08 20100100 55810e10 000412a0 00100000 03002000 2200300d 00400880 000908c0 08310004 4001b000 1e008882 0060a801 801204c0 020c010c 10000200 02000006 00600408 00020a01 c0020100 38278e08 23804043 93500018 00143880 c0000001 08124000 90000000 0c000104 0186000b 20044200 00006620 |