On Target ADRB2_HUMAN 0.36956522/CHEMBL1728955
For the given ligand lvkui, we have found in our database that, being scored 0.36956522, the most similar ligand is CHEMBL1728955. Check out the elaboration below.
| lvkui (Given Ligand) | CHEMBL1728955 (Similar Ligand) |
|---|---|
| CC(C)c3ccc2oc1nc(N)c(C(=O)O)cc1c(=O)c2c3 | CCOC(=O)C1=CN(C2CC2)c3c(F)c(NCCCN(C)C)c(F)cc3C1=O |
|
|
|
|
|
|
| 00000002 00a40800 00084100 00010210 00041600 80014060 00000400 40000200 02084120 40080850 08000024 4000b002 40008c00 01600088 00020050 000c000c 00000000 42004004 04200080 00600000 c8000000 0e068a68 20a04800 8078001c 08040050 80000005 88000090 18140000 00402008 01860002 c0140000 80000400 | 00004002 00809800 00104300 06010610 20041012 0000c070 00008000 00000000 12000100 c00109e0 00200004 d0018000 01008900 01611000 000200c0 020c000d 00060400 82086004 08210000 00400000 e0100200 18068a78 20800004 8050001c 00040400 80002000 08088080 10040083 04408200 00078050 c0040800 00000240 |