On Target PPARG_HUMAN 0.39449543/CHEMBL149309
For the given ligand lvkui, we have found in our database that, being scored 0.39449543, the most similar ligand is CHEMBL149309. Check out the elaboration below.
| lvkui (Given Ligand) | CHEMBL149309 (Similar Ligand) |
|---|---|
| CC(C)c3ccc2oc1nc(N)c(C(=O)O)cc1c(=O)c2c3 | CN(CCOc1ccc(CC(Nc2ccncc2C(=O)c3ccccc3)C(=O)O)cc1)c4oc5ccccc5n4 |
|
|
|
|
|
|
| 00000002 00a40800 00084100 00010210 00041600 80014060 00000400 40000200 02084120 40080850 08000024 4000b002 40008c00 01600088 00020050 000c000c 00000000 42004004 04200080 00600000 c8000000 0e068a68 20a04800 8078001c 08040050 80000005 88000090 18140000 00402008 01860002 c0140000 80000400 | 1c002002 00804828 201a7108 00010612 200412a0 00098040 0204a400 01100300 00c84a20 200c0850 08300004 4000b000 44829c02 01600000 01021041 000c000e 00058000 42005005 00600488 40a20001 c0180100 1c268f00 37c08840 8578001d 00040800 a8000080 08128010 58001080 04482288 01060802 80145081 20000650 |