On Target PDE4B_HUMAN 0.4212766/CHEMBL1830790
For the given ligand lvkui, we have found in our database that, being scored 0.4212766, the most similar ligand is CHEMBL1830790. Check out the elaboration below.
| lvkui (Given Ligand) | CHEMBL1830790 (Similar Ligand) |
|---|---|
| CC(C)c3ccc2oc1nc(N)c(C(=O)O)cc1c(=O)c2c3 | CCNc1nc2oc3c(NCc4cccnc4)ncnc3c2c5CC(C)(C)CCc15 |
|
|
|
|
|
|
| 00000002 00a40800 00084100 00010210 00041600 80014060 00000400 40000200 02084120 40080850 08000024 4000b002 40008c00 01600088 00020050 000c000c 00000000 42004004 04200080 00600000 c8000000 0e068a68 20a04800 8078001c 08040050 80000005 88000090 18140000 00402008 01860002 c0140000 80000400 | 10014002 01a1e800 c0084106 48cdc610 00041726 20004042 0120ec00 42201a09 004a4920 a0880050 0d300024 4000f002 cc000c00 01e00c80 00020070 400e4684 000c8220 42014004 0ee02488 00a00001 4c104100 0e048868 20a14840 a4780050 02042010 80000081 a80005f0 98001090 0048a10a 03460802 40141080 a00006e0 |