On Target ACM4_HUMAN 0.30481285/CHEMBL1223806
For the given ligand lvkui, we have found in our database that, being scored 0.30481285, the most similar ligand is CHEMBL1223806. Check out the elaboration below.
| lvkui (Given Ligand) | CHEMBL1223806 (Similar Ligand) |
|---|---|
| CC(C)c3ccc2oc1nc(N)c(C(=O)O)cc1c(=O)c2c3 | CO[C@@H]1CC[C@](C)(CC1)N2CCC(CC2)N3C(=O)Oc4ccc(C)cc34 |
|
|
|
|
|
|
| 00000002 00a40800 00084100 00010210 00041600 80014060 00000400 40000200 02084120 40080850 08000024 4000b002 40008c00 01600088 00020050 000c000c 00000000 42004004 04200080 00600000 c8000000 0e068a68 20a04800 8078001c 08040050 80000005 88000090 18140000 00402008 01860002 c0140000 80000400 | 00000002 01000c00 00180100 00010700 001c0e10 00400080 00000400 a0000600 04284020 800009f0 04200024 50c1a000 c0008402 01e40100 00100040 000c000c 00900000 42800000 02602080 50000201 40000000 1a000010 21800018 04780010 10000000 c0000000 00000370 18000010 02006200 03060010 00160000 00002a20 |