On Target BACE1_HUMAN 0.37575758/CHEMBL1821830
For the given ligand lvkui, we have found in our database that, being scored 0.37575758, the most similar ligand is CHEMBL1821830. Check out the elaboration below.
| lvkui (Given Ligand) | CHEMBL1821830 (Similar Ligand) |
|---|---|
| CC(C)c3ccc2oc1nc(N)c(C(=O)O)cc1c(=O)c2c3 | CC(Cc1cc2cc(ccc2nc1N)c3ccccc3C(=O)C)C(=O)NCCC(C)(C)C |
|
|
|
|
|
|
| 00000002 00a40800 00084100 00010210 00041600 80014060 00000400 40000200 02084120 40080850 08000024 4000b002 40008c00 01600088 00020050 000c000c 00000000 42004004 04200080 00600000 c8000000 0e068a68 20a04800 8078001c 08040050 80000005 88000090 18140000 00402008 01860002 c0140000 80000400 | 08002002 00005a01 00104100 00810610 00041201 00008000 02002000 20000000 00400800 000808c0 08300004 40009000 04008802 00600800 20020040 00040004 00020000 02000004 04200408 00200203 40000100 1c068608 30804800 8060001c 00841800 80000000 08000080 10000040 00404008 0006000b 80040000 20002600 |