On Target NEP_HUMAN 0.2970297/CHEMBL3677667
For the given ligand lvkui, we have found in our database that, being scored 0.2970297, the most similar ligand is CHEMBL3677667. Check out the elaboration below.
| lvkui (Given Ligand) | CHEMBL3677667 (Similar Ligand) |
|---|---|
| CC(C)c3ccc2oc1nc(N)c(C(=O)O)cc1c(=O)c2c3 | C[C@H](C[C@@H](Cc1ccc(cc1)c2ccccc2)NC(=O)C3=CC(=O)C=C(O3)C(=O)O)C(=O)O |
|
|
|
|
|
|
| 00000002 00a40800 00084100 00010210 00041600 80014060 00000400 40000200 02084120 40080850 08000024 4000b002 40008c00 01600088 00020050 000c000c 00000000 42004004 04200080 00600000 c8000000 0e068a68 20a04800 8078001c 08040050 80000005 88000090 18140000 00402008 01860002 c0140000 80000400 | 00032080 01201800 00180103 00010600 04180001 80004000 00000400 22041004 0200c980 000808c0 08302010 4000b80c 44408c0a 00a00088 00000420 00080008 00024000 02000400 06402000 10000201 00000100 18268e20 11000000 c158021c 20800000 e0000080 04100034 98100040 04006183 0d864003 e0040000 00800e00 |