On Target HPGDS_HUMAN 0.30481285/CHEMBL3425968
For the given ligand lvkui, we have found in our database that, being scored 0.30481285, the most similar ligand is CHEMBL3425968. Check out the elaboration below.
| lvkui (Given Ligand) | CHEMBL3425968 (Similar Ligand) |
|---|---|
| CC(C)c3ccc2oc1nc(N)c(C(=O)O)cc1c(=O)c2c3 | FC(F)(F)CN1CCC(CC1)NC(=O)c2ccc(nc2)C3=CC=CC(=O)N3 |
|
|
|
|
|
|
| 00000002 00a40800 00084100 00010210 00041600 80014060 00000400 40000200 02084120 40080850 08000024 4000b002 40008c00 01600088 00020050 000c000c 00000000 42004004 04200080 00600000 c8000000 0e068a68 20a04800 8078001c 08040050 80000005 88000090 18140000 00402008 01860002 c0140000 80000400 | 10002002 01809c00 00104100 50000610 00041020 00000040 00004800 22081000 06000100 d00001f0 05208004 50050800 80008802 00600000 00120480 020c0004 00020060 12002004 04200000 10600201 c1000000 180c8e00 30800000 0070011c 00040002 c0000000 08000040 90000040 0040410c 00060411 e0000800 80000200 |