On Target NK1R_HUMAN 0.36206895/CHEMBL451773
For the given ligand lvkui, we have found in our database that, being scored 0.36206895, the most similar ligand is CHEMBL451773. Check out the elaboration below.
| lvkui (Given Ligand) | CHEMBL451773 (Similar Ligand) |
|---|---|
| CC(C)c3ccc2oc1nc(N)c(C(=O)O)cc1c(=O)c2c3 | CN(Cc1cc(cc(c1)C(F)(F)F)C(F)(F)F)C(=O)c2c(c3ccccc3)c4ccccc4n5ccnc25 |
|
|
|
|
|
|
| 00000002 00a40800 00084100 00010210 00041600 80014060 00000400 40000200 02084120 40080850 08000024 4000b002 40008c00 01600088 00020050 000c000c 00000000 42004004 04200080 00600000 c8000000 0e068a68 20a04800 8078001c 08040050 80000005 88000090 18140000 00402008 01860002 c0140000 80000400 | 18002002 008a8801 00104100 10050610 00041041 0000c000 1000c400 02001000 00400100 10000850 01208004 60008002 80008802 01e00000 20040440 000c000c 08022000 02000004 04200000 00400000 c0020000 08068e28 31800020 8040000c 00040000 c0000000 0800c000 90000044 00404100 00460001 c0140000 800002a0 |