On Target ALDR_HUMAN 0.39473686/CHEMBL282245
For the given ligand lvkui, we have found in our database that, being scored 0.39473686, the most similar ligand is CHEMBL282245. Check out the elaboration below.
| lvkui (Given Ligand) | CHEMBL282245 (Similar Ligand) |
|---|---|
| CC(C)c3ccc2oc1nc(N)c(C(=O)O)cc1c(=O)c2c3 | CN(C)S(=O)(=O)c1ccc2Oc3ccc(cc3C(=O)c2c1)C(=O)O |
|
|
|
|
|
|
| 00000002 00a40800 00084100 00010210 00041600 80014060 00000400 40000200 02084120 40080850 08000024 4000b002 40008c00 01600088 00020050 000c000c 00000000 42004004 04200080 00600000 c8000000 0e068a68 20a04800 8078001c 08040050 80000005 88000090 18140000 00402008 01860002 c0140000 80000400 | 00000010 00a00800 01080100 00b10200 00000200 80004020 10000000 40000200 02004100 40000840 00202020 60008000 40008400 00200189 80200000 00080008 00002000 0a000000 00c00000 00006002 80000000 0a060a28 00004000 0858000c 08080040 80000004 00000010 0810000c 00002400 21860000 e0000000 00010060 |