On Target AOFB_HUMAN 0.40298507/CHEMBL315361
For the given ligand lvkui, we have found in our database that, being scored 0.40298507, the most similar ligand is CHEMBL315361. Check out the elaboration below.
| lvkui (Given Ligand) | CHEMBL315361 (Similar Ligand) |
|---|---|
| CC(C)c3ccc2oc1nc(N)c(C(=O)O)cc1c(=O)c2c3 | OC(=O)C1=COc2ccccc2C1=O |
|
|
|
|
|
|
| 00000002 00a40800 00084100 00010210 00041600 80014060 00000400 40000200 02084120 40080850 08000024 4000b002 40008c00 01600088 00020050 000c000c 00000000 42004004 04200080 00600000 c8000000 0e068a68 20a04800 8078001c 08040050 80000005 88000090 18140000 00402008 01860002 c0140000 80000400 | 00000000 00208800 00080100 00010200 00000203 80004120 00010000 40000200 02004100 40000840 00080020 40008400 40008401 00300088 00000000 40080008 00000000 02000000 00000000 00000000 00000000 0a060a28 00000000 00580004 08000040 80004000 00000010 08900000 00002000 01820000 c0000000 00000000 |