On Target GRM5_HUMAN 0.41899443/CHEMBL439571
For the given ligand lvkui, we have found in our database that, being scored 0.41899443, the most similar ligand is CHEMBL439571. Check out the elaboration below.
| lvkui (Given Ligand) | CHEMBL439571 (Similar Ligand) |
|---|---|
| CC(C)c3ccc2oc1nc(N)c(C(=O)O)cc1c(=O)c2c3 | O=C(Nc1ccccn1)c2cccc3OC(=O)Nc23 |
|
|
|
|
|
|
| 00000002 00a40800 00084100 00010210 00041600 80014060 00000400 40000200 02084120 40080850 08000024 4000b002 40008c00 01600088 00020050 000c000c 00000000 42004004 04200080 00600000 c8000000 0e068a68 20a04800 8078001c 08040050 80000005 88000090 18140000 00402008 01860002 c0140000 80000400 | 10004002 00020800 00086106 00110610 00050210 00400000 00004400 02001200 040a4120 20000870 04380004 40c0e002 40008c00 01700000 40100040 000c0004 00040000 42024000 0a200080 50a00000 c0100000 0c028e04 20a12808 0478040c 00040000 c0000080 00400090 98000080 0200a108 01060803 80141000 a0000300 |