On Target MDR1_HUMAN 0.38121548/CHEMBL583
For the given ligand lvkui, we have found in our database that, being scored 0.38121548, the most similar ligand is CHEMBL583. Check out the elaboration below.
| lvkui (Given Ligand) | CHEMBL583 (Similar Ligand) |
|---|---|
| CC(C)c3ccc2oc1nc(N)c(C(=O)O)cc1c(=O)c2c3 | CC1CN(CCN1)c2cc3N(C=C(C(=O)O)C(=O)c3c(C)c2F)C4CC4 |
|
|
|
|
|
|
| 00000002 00a40800 00084100 00010210 00041600 80014060 00000400 40000200 02084120 40080850 08000024 4000b002 40008c00 01600088 00020050 000c000c 00000000 42004004 04200080 00600000 c8000000 0e068a68 20a04800 8078001c 08040050 80000005 88000090 18140000 00402008 01860002 c0140000 80000400 | 00004002 00809800 40104320 46050610 20041002 0000c070 00008000 00000000 02000100 c0000ad0 00200004 50018000 80008802 01603000 000200c0 000c000d 00040600 82804004 08200000 00400200 c0100000 38068a78 60800025 8250001e 00040000 80000000 080080e0 10040081 08408000 00078040 c0040000 00000260 |