On Target OPRM_MOUSE 0.29268292/CHEMBL363677
For the given ligand lvkui, we have found in our database that, being scored 0.29268292, the most similar ligand is CHEMBL363677. Check out the elaboration below.
| lvkui (Given Ligand) | CHEMBL363677 (Similar Ligand) |
|---|---|
| CC(C)c3ccc2oc1nc(N)c(C(=O)O)cc1c(=O)c2c3 | CCNC(=O)c1ccc(cc1)C(=C2CC3CCC(C2)N3Cc4cocc4)c5cnc6ccccc6c5 |
|
|
|
|
|
|
| 00000002 00a40800 00084100 00010210 00041600 80014060 00000400 40000200 02084120 40080850 08000024 4000b002 40008c00 01600088 00020050 000c000c 00000000 42004004 04200080 00600000 c8000000 0e068a68 20a04800 8078001c 08040050 80000005 88000090 18140000 00402008 01860002 c0140000 80000400 | 08000002 09204800 00184300 42110610 00041005 00000010 80082080 23201410 00424100 001828c8 0c200004 50018800 c0028c02 00400000 00004442 20440004 00010400 02030044 00202400 00000203 41000000 1802861e 20808020 8058001c 01040004 e0004000 88406010 d8801000 00400180 00060c03 a4060000 00002600 |