On Target SCN9A_HUMAN 0.315/CHEMBL3920545
For the given ligand lvkui, we have found in our database that, being scored 0.315, the most similar ligand is CHEMBL3920545. Check out the elaboration below.
| lvkui (Given Ligand) | CHEMBL3920545 (Similar Ligand) |
|---|---|
| CC(C)c3ccc2oc1nc(N)c(C(=O)O)cc1c(=O)c2c3 | NC(=O)C(O)(c1cn(c2ccc(Oc3ccc(C#N)c(c3)C(F)(F)F)cc2)c4ccccc14)C(F)(F)F |
|
|
|
|
|
|
| 00000002 00a40800 00084100 00010210 00041600 80014060 00000400 40000200 02084120 40080850 08000024 4000b002 40008c00 01600088 00020050 000c000c 00000000 42004004 04200080 00600000 c8000000 0e068a68 20a04800 8078001c 08040050 80000005 88000090 18140000 00402008 01860002 c0140000 80000400 | 00008002 40000a08 20180108 41010610 00045020 0000c060 02242400 00001008 00500100 c08908d0 08000004 4001d028 13008802 01600000 c1000041 000c000c 00400000 82800000 00a82500 00022200 44400000 18008678 22800481 81580014 02042000 80000000 08060040 90200800 04000280 1006040a c0142600 01000620 |