On Target PRGR_HUMAN 0.35403726/CHEMBL1835813
For the given ligand lvkui, we have found in our database that, being scored 0.35403726, the most similar ligand is CHEMBL1835813. Check out the elaboration below.
| lvkui (Given Ligand) | CHEMBL1835813 (Similar Ligand) |
|---|---|
| CC(C)c3ccc2oc1nc(N)c(C(=O)O)cc1c(=O)c2c3 | CCN(CC)c1cc2OC(=O)C=Cc2cc1c3ccc(cc3)C(=O)C |
|
|
|
|
|
|
| 00000002 00a40800 00084100 00010210 00041600 80014060 00000400 40000200 02084120 40080850 08000024 4000b002 40008c00 01600088 00020050 000c000c 00000000 42004004 04200080 00600000 c8000000 0e068a68 20a04800 8078001c 08040050 80000005 88000090 18140000 00402008 01860002 c0140000 80000400 | 00006002 00200800 00080100 40010602 00020210 00400060 00200000 40080200 02044100 40080840 08200124 40508800 40008402 00200080 002200c0 00800000 04060000 02002000 0c000000 10000000 40100000 1a020208 30000008 00580014 08000008 80000000 00000010 081010c0 0200e000 01060002 80000800 00000600 |