On Target DRD4_HUMAN 0.3478261/CHEMBL3818940
For the given ligand lvkui, we have found in our database that, being scored 0.3478261, the most similar ligand is CHEMBL3818940. Check out the elaboration below.
| lvkui (Given Ligand) | CHEMBL3818940 (Similar Ligand) |
|---|---|
| CC(C)c3ccc2oc1nc(N)c(C(=O)O)cc1c(=O)c2c3 | OC1(CCN(CCCCc2oc3ccccc3n2)CC1)c4ccc(Cl)cc4 |
|
|
|
|
|
|
| 00000002 00a40800 00084100 00010210 00041600 80014060 00000400 40000200 02084120 40080850 08000024 4000b002 40008c00 01600088 00020050 000c000c 00000000 42004004 04200080 00600000 c8000000 0e068a68 20a04800 8078001c 08040050 80000005 88000090 18140000 00402008 01860002 c0140000 80000400 | 0040800a 01000200 80180100 10010640 00040220 00004008 01000400 20000200 00084920 000a08d0 08308004 5081a900 420804a6 01600000 00020060 020c000c 00004000 46000000 00a00088 40000201 40200500 18000120 21804080 04580010 00002001 80000201 04040014 18040080 00002004 0186000a 40140000 60022600 |