On Target PGH2_HUMAN 0.42/CHEMBL63323
For the given ligand lvkui, we have found in our database that, being scored 0.42, the most similar ligand is CHEMBL63323. Check out the elaboration below.
| lvkui (Given Ligand) | CHEMBL63323 (Similar Ligand) |
|---|---|
| CC(C)c3ccc2oc1nc(N)c(C(=O)O)cc1c(=O)c2c3 | OC(=O)c1cccnc1Nc2cccc(c2)C(F)(F)F |
|
|
|
|
|
|
| 00000002 00a40800 00084100 00010210 00041600 80014060 00000400 40000200 02084120 40080850 08000024 4000b002 40008c00 01600088 00020050 000c000c 00000000 42004004 04200080 00600000 c8000000 0e068a68 20a04800 8078001c 08040050 80000005 88000090 18140000 00402008 01860002 c0140000 80000400 | 00000002 00800800 00104100 00010210 00041000 00014000 00000410 00000040 00802100 00000850 00200004 40009804 04008800 01000000 00020040 000c000c 00040000 12004004 0820800a 10a00010 c1000000 0c048a40 20800800 0060000c 00040000 80000000 0a000080 90011080 00408008 00260800 c0100000 00000200 |