On Target GLRA3_HUMAN 0.27155173/CHEMBL4074873
For the given ligand lvkui, we have found in our database that, being scored 0.27155173, the most similar ligand is CHEMBL4074873. Check out the elaboration below.
| lvkui (Given Ligand) | CHEMBL4074873 (Similar Ligand) |
|---|---|
| CC(C)c3ccc2oc1nc(N)c(C(=O)O)cc1c(=O)c2c3 | CN1C(=O)[C@@H]2CN(C[C@@H]2c3cnccc13)S(=O)(=O)c4ccc5occc5c4 |
|
|
|
|
|
|
| 00000002 00a40800 00084100 00010210 00041600 80014060 00000400 40000200 02084120 40080850 08000024 4000b002 40008c00 01600088 00020050 000c000c 00000000 42004004 04200080 00600000 c8000000 0e068a68 20a04800 8078001c 08040050 80000005 88000090 18140000 00402008 01860002 c0140000 80000400 | 00020052 22a04600 01184100 01b00610 200c1200 00002050 1201a000 40200200 00604880 004909e0 00382034 60029000 4c008c03 00100981 80e20000 00040006 0004e004 0a000004 00600418 00007e03 e0100100 18248608 20804000 99480018 0a041800 0100000c 08028010 1800108c 04482400 21060a1b 00000080 20812670 |