On Target TRY1_HUMAN 0.31862745/CHEMBL165932
For the given ligand lvkui, we have found in our database that, being scored 0.31862745, the most similar ligand is CHEMBL165932. Check out the elaboration below.
| lvkui (Given Ligand) | CHEMBL165932 (Similar Ligand) |
|---|---|
| CC(C)c3ccc2oc1nc(N)c(C(=O)O)cc1c(=O)c2c3 | CCN(C1=Nc2ccccc2C(=O)O1)S(=O)(=O)c3ccc(Cl)cc3 |
|
|
|
|
|
|
| 00000002 00a40800 00084100 00010210 00041600 80014060 00000400 40000200 02084120 40080850 08000024 4000b002 40008c00 01600088 00020050 000c000c 00000000 42004004 04200080 00600000 c8000000 0e068a68 20a04800 8078001c 08040050 80000005 88000090 18140000 00402008 01860002 c0140000 80000400 | 00008012 00884200 010a0200 01b00600 000c0222 10408060 00000401 01000240 03084220 60800854 00202004 6008a800 42008404 01600001 80200040 00240204 00002000 40005004 00600480 00a06001 c0080000 0e201108 20c00904 08780008 02002000 00000084 10400030 1c04000c 02012408 210e0d88 80141080 80030270 |