On Target ACE_HUMAN 0.26903552/CHEMBL264538
For the given ligand lvkui, we have found in our database that, being scored 0.26903552, the most similar ligand is CHEMBL264538. Check out the elaboration below.
| lvkui (Given Ligand) | CHEMBL264538 (Similar Ligand) |
|---|---|
| CC(C)c3ccc2oc1nc(N)c(C(=O)O)cc1c(=O)c2c3 | C[C@H](NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@H](CCCCN)NC(=O)[C@@H]3CCC(=O)N3)C(=O)N4CCC[C@H]4C(=O)O |
|
|
|
|
|
|
| 00000002 00a40800 00084100 00010210 00041600 80014060 00000400 40000200 02084120 40080850 08000024 4000b002 40008c00 01600088 00020050 000c000c 00000000 42004004 04200080 00600000 c8000000 0e068a68 20a04800 8078001c 08040050 80000005 88000090 18140000 00402008 01860002 c0140000 80000400 | 00030002 01007a00 00100100 45810610 000c1280 00000010 00002000 2000000c 00400880 000b08c0 08300004 4001b000 1e00881a 01402801 80180040 000c000c 10000000 02000000 00602408 00000201 40000100 38248e38 23800003 93500018 00043800 80000000 08000000 10000000 0c000000 0006000b 20044200 00002620 |