On Target 5HT1B_HUMAN 0.3505747/CHEMBL302263
For the given ligand lvkui, we have found in our database that, being scored 0.3505747, the most similar ligand is CHEMBL302263. Check out the elaboration below.
| lvkui (Given Ligand) | CHEMBL302263 (Similar Ligand) |
|---|---|
| CC(C)c3ccc2oc1nc(N)c(C(=O)O)cc1c(=O)c2c3 | CCCN(CCC)C1CCc2ccc3[nH]cc(C(=O)C(F)(F)F)c3c2C1 |
|
|
|
|
|
|
| 00000002 00a40800 00084100 00010210 00041600 80014060 00000400 40000200 02084120 40080850 08000024 4000b002 40008c00 01600088 00020050 000c000c 00000000 42004004 04200080 00600000 c8000000 0e068a68 20a04800 8078001c 08040050 80000005 88000090 18140000 00402008 01860002 c0140000 80000400 | 00000002 01805a00 00100102 40010610 00041020 00000060 00002000 20000005 00400980 c0080ac0 08300004 40808800 98008802 00600000 00000040 0a0c000c 00000200 02000004 00202400 00200205 c0000100 18228208 21804000 8150001c 02042000 80000001 08000040 90800000 04400002 0006000a 80040200 00002620 |