On Target TLR4_HUMAN 0.47712418/CHEMBL2419462
For the given ligand lvkui, we have found in our database that, being scored 0.47712418, the most similar ligand is CHEMBL2419462. Check out the elaboration below.
| lvkui (Given Ligand) | CHEMBL2419462 (Similar Ligand) |
|---|---|
| CC(C)c3ccc2oc1nc(N)c(C(=O)O)cc1c(=O)c2c3 | CC(C)(O)c1oc2c(N)nc3ccccc3c2c1 |
|
|
|
|
|
|
| 00000002 00a40800 00084100 00010210 00041600 80014060 00000400 40000200 02084120 40080850 08000024 4000b002 40008c00 01600088 00020050 000c000c 00000000 42004004 04200080 00600000 c8000000 0e068a68 20a04800 8078001c 08040050 80000005 88000090 18140000 00402008 01860002 c0140000 80000400 | 00400002 00200000 80084101 00010240 00040602 00404820 00200000 40200200 00004100 400a0840 08000024 4000a800 40080c00 00600080 00000060 400c408c 00004000 42000000 0c200000 00240020 40000000 0c008028 20800800 a4780010 60000050 a0000000 040000d4 08000010 00402009 03060002 40040000 00000400 |