On Target CNR2_HUMAN 0.43809524/CHEMBL1089351
For the given ligand lvkui, we have found in our database that, being scored 0.43809524, the most similar ligand is CHEMBL1089351. Check out the elaboration below.
| lvkui (Given Ligand) | CHEMBL1089351 (Similar Ligand) |
|---|---|
| CC(C)c3ccc2oc1nc(N)c(C(=O)O)cc1c(=O)c2c3 | CC(C)(C)C(=O)c1oc2nc(c3ccc(Cl)cc3Cl)c(cc2c1N)c4ccc(Cl)cc4 |
|
|
|
|
|
|
| 00000002 00a40800 00084100 00010210 00041600 80014060 00000400 40000200 02084120 40080850 08000024 4000b002 40008c00 01600088 00020050 000c000c 00000000 42004004 04200080 00600000 c8000000 0e068a68 20a04800 8078001c 08040050 80000005 88000090 18140000 00402008 01860002 c0140000 80000400 | 0050a002 00204811 80084100 1001c210 00041623 14410028 00008400 4c280200 120c4920 10080851 0c1000a4 4010b802 42088c04 01600480 20020060 82050084 00024000 46002004 06200088 0040002b 4c000100 0a068308 30a00000 a0588234 00042019 e0080200 0c0482f4 18040040 004060ac 03060402 80140800 23020440 |