On Target MTOR_HUMAN 0.45762712/CHEMBL3890780
For the given ligand lvkui, we have found in our database that, being scored 0.45762712, the most similar ligand is CHEMBL3890780. Check out the elaboration below.
| lvkui (Given Ligand) | CHEMBL3890780 (Similar Ligand) |
|---|---|
| CC(C)c3ccc2oc1nc(N)c(C(=O)O)cc1c(=O)c2c3 | CC(C)n1cc(c2ccc3oc(N)nc3c2)c4c(N)ncnc14 |
|
|
|
|
|
|
| 00000002 00a40800 00084100 00010210 00041600 80014060 00000400 40000200 02084120 40080850 08000024 4000b002 40008c00 01600088 00020050 000c000c 00000000 42004004 04200080 00600000 c8000000 0e068a68 20a04800 8078001c 08040050 80000005 88000090 18140000 00402008 01860002 c0140000 80000400 | 00002002 00800800 000a0100 080d0610 200c1204 0400e048 00008400 00000a00 00084320 000408d0 0000002c 6011b000 40000c00 01e00000 000200c0 900c000c 00020000 c2800008 04600080 40200000 c0000000 1e028070 31c08840 0478001c 00040001 80080000 08008350 18000040 00016008 01460000 c0140200 000004f0 |